C14H19F2NO — CID 116576864
3-(aminomethyl)-1-(2,6-difluorophenyl)-5-methylhexan-1-one (PubChem CID 116576864) has the molecular formula C14H19F2NO and a molecular weight of 255.31 g/mol. Its IUPAC name is 3-(aminomethyl)-1-(2,6-difluorophenyl)-5-methylhexan-1-one.
| Compound Name | 3-(aminomethyl)-1-(2,6-difluorophenyl)-5-methylhexan-1-one |
|---|---|
| PubChem CID | 116576864 |
| Molecular Formula | C14H19F2NO |
| Molecular Weight | 255.31 g/mol |
| Exact Mass | 255.14 |
| IUPAC Name | 3-(aminomethyl)-1-(2,6-difluorophenyl)-5-methylhexan-1-one |
| SMILES | CC(C)CC(CN)CC(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C14H19F2NO/c1-9(2)6-10(8-17)7-13(18)14-11(15)4-3-5-12(14)16/h3-5,9-10H,6-8,17H2,1-2H3 |
| InChIKey | DNBCQPHWUNMGFO-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.31 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |