C14H17F2NO — CID 116579252
(1-amino-3-methylcyclohexyl)-(2,4-difluorophenyl)methanone (PubChem CID 116579252) has the molecular formula C14H17F2NO and a molecular weight of 253.29 g/mol. Its IUPAC name is (1-amino-3-methylcyclohexyl)-(2,4-difluorophenyl)methanone.
| Compound Name | (1-amino-3-methylcyclohexyl)-(2,4-difluorophenyl)methanone |
|---|---|
| PubChem CID | 116579252 |
| Molecular Formula | C14H17F2NO |
| Molecular Weight | 253.29 g/mol |
| Exact Mass | 253.13 |
| IUPAC Name | (1-amino-3-methylcyclohexyl)-(2,4-difluorophenyl)methanone |
| SMILES | CC1CCCC(N)(C(=O)c2ccc(F)cc2F)C1 |
| InChI | InChI=1S/C14H17F2NO/c1-9-3-2-6-14(17,8-9)13(18)11-5-4-10(15)7-12(11)16/h4-5,7,9H,2-3,6,8,17H2,1H3 |
| InChIKey | FJQVMSXLQMDINE-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.29 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |