C16H19NOS — CID 116582553
1-(azepan-2-yl)-2-(1-benzothiophen-3-yl)ethanone (PubChem CID 116582553) has the molecular formula C16H19NOS and a molecular weight of 273.40 g/mol. Its IUPAC name is 1-(azepan-2-yl)-2-(1-benzothiophen-3-yl)ethanone.
| Compound Name | 1-(azepan-2-yl)-2-(1-benzothiophen-3-yl)ethanone |
|---|---|
| PubChem CID | 116582553 |
| Molecular Formula | C16H19NOS |
| Molecular Weight | 273.40 g/mol |
| Exact Mass | 273.12 |
| IUPAC Name | 1-(azepan-2-yl)-2-(1-benzothiophen-3-yl)ethanone |
| SMILES | O=C(Cc1csc2ccccc12)C1CCCCCN1 |
| InChI | InChI=1S/C16H19NOS/c18-15(14-7-2-1-5-9-17-14)10-12-11-19-16-8-4-3-6-13(12)16/h3-4,6,8,11,14,17H,1-2,5,7,9-10H2 |
| InChIKey | HYPSWEWMJKPIHR-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |