C14H14OS2 — CID 80621447
2-(1-benzothiophen-3-yl)-1-(thiolan-2-yl)ethanone (PubChem CID 80621447) has the molecular formula C14H14OS2 and a molecular weight of 262.40 g/mol. Its IUPAC name is 2-(1-benzothiophen-3-yl)-1-(thiolan-2-yl)ethanone.
| Compound Name | 2-(1-benzothiophen-3-yl)-1-(thiolan-2-yl)ethanone |
|---|---|
| PubChem CID | 80621447 |
| Molecular Formula | C14H14OS2 |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.05 |
| IUPAC Name | 2-(1-benzothiophen-3-yl)-1-(thiolan-2-yl)ethanone |
| SMILES | O=C(Cc1csc2ccccc12)C1CCCS1 |
| InChI | InChI=1S/C14H14OS2/c15-12(14-6-3-7-16-14)8-10-9-17-13-5-2-1-4-11(10)13/h1-2,4-5,9,14H,3,6-8H2 |
| InChIKey | MGPGJUITVBFGSH-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |