About 2-prop-2-ynylphenol
2-prop-2-ynylphenol (PubChem CID 11658299) has the molecular formula C9H8O
and a molecular weight of 132.16 g/mol. Its IUPAC name is 2-prop-2-ynylphenol.
Molecular Properties
| Compound Name | 2-prop-2-ynylphenol |
| PubChem CID | 11658299 |
| Molecular Formula | C9H8O |
| Molecular Weight | 132.16 g/mol |
| Exact Mass | 132.06 |
| IUPAC Name | 2-prop-2-ynylphenol |
| SMILES | C#CCc1ccccc1O |
| InChI | InChI=1S/C9H8O/c1-2-5-8-6-3-4-7-9(8)10/h1,3-4,6-7,10H,5H2 |
| InChIKey | ZHDGEEPULWOWON-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.16 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 2-prop-2-ynylphenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-prop-2-ynylphenol?
The IUPAC name of 2-prop-2-ynylphenol (CID 11658299) is 2-prop-2-ynylphenol.
What is the SMILES notation for 2-prop-2-ynylphenol?
The canonical SMILES for 2-prop-2-ynylphenol is C#CCc1ccccc1O.
What is the InChIKey of 2-prop-2-ynylphenol?
The InChIKey is ZHDGEEPULWOWON-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H8O/c1-2-5-8-6-3-4-7-9(8)10/h1,3-4,6-7,10H,5H2.
What are the key properties of 2-prop-2-ynylphenol?
2-prop-2-ynylphenol has a molecular weight of 132.16 g/mol, XLogP of 1.57, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-prop-2-ynylphenol is sourced from PubChem (CID 11658299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).