C13H16FNO — CID 116583575
1-(4-fluoro-2-methylphenyl)-2-pyrrolidin-3-ylethanone (PubChem CID 116583575) has the molecular formula C13H16FNO and a molecular weight of 221.28 g/mol. Its IUPAC name is 1-(4-fluoro-2-methylphenyl)-2-pyrrolidin-3-ylethanone.
| Compound Name | 1-(4-fluoro-2-methylphenyl)-2-pyrrolidin-3-ylethanone |
|---|---|
| PubChem CID | 116583575 |
| Molecular Formula | C13H16FNO |
| Molecular Weight | 221.28 g/mol |
| Exact Mass | 221.12 |
| IUPAC Name | 1-(4-fluoro-2-methylphenyl)-2-pyrrolidin-3-ylethanone |
| SMILES | Cc1cc(F)ccc1C(=O)CC1CCNC1 |
| InChI | InChI=1S/C13H16FNO/c1-9-6-11(14)2-3-12(9)13(16)7-10-4-5-15-8-10/h2-3,6,10,15H,4-5,7-8H2,1H3 |
| InChIKey | WRAJWRKESXQNTQ-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |