C15H13N3OS — CID 116585498
[2-(2-aminoethyl)-1,3-thiazol-4-yl]-quinolin-6-ylmethanone (PubChem CID 116585498) has the molecular formula C15H13N3OS and a molecular weight of 283.36 g/mol. Its IUPAC name is [2-(2-aminoethyl)-1,3-thiazol-4-yl]-quinolin-6-ylmethanone.
| Compound Name | [2-(2-aminoethyl)-1,3-thiazol-4-yl]-quinolin-6-ylmethanone |
|---|---|
| PubChem CID | 116585498 |
| Molecular Formula | C15H13N3OS |
| Molecular Weight | 283.36 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | [2-(2-aminoethyl)-1,3-thiazol-4-yl]-quinolin-6-ylmethanone |
| SMILES | NCCc1nc(C(=O)c2ccc3ncccc3c2)cs1 |
| InChI | InChI=1S/C15H13N3OS/c16-6-5-14-18-13(9-20-14)15(19)11-3-4-12-10(8-11)2-1-7-17-12/h1-4,7-9H,5-6,16H2 |
| InChIKey | ISVJFJXEKYRPRD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 68.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.36 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |