C12H7N3OS — CID 105121566
quinolin-6-yl(1,2,5-thiadiazol-3-yl)methanone (PubChem CID 105121566) has the molecular formula C12H7N3OS and a molecular weight of 241.28 g/mol. Its IUPAC name is quinolin-6-yl(1,2,5-thiadiazol-3-yl)methanone.
| Compound Name | quinolin-6-yl(1,2,5-thiadiazol-3-yl)methanone |
|---|---|
| PubChem CID | 105121566 |
| Molecular Formula | C12H7N3OS |
| Molecular Weight | 241.28 g/mol |
| Exact Mass | 241.03 |
| IUPAC Name | quinolin-6-yl(1,2,5-thiadiazol-3-yl)methanone |
| SMILES | O=C(c1ccc2ncccc2c1)c1cnsn1 |
| InChI | InChI=1S/C12H7N3OS/c16-12(11-7-14-17-15-11)9-3-4-10-8(6-9)2-1-5-13-10/h1-7H |
| InChIKey | GPDFONQLZQZRQI-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 55.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.28 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |