C13H15NO — CID 116589428
1-(2,3-dimethylphenyl)-2-(prop-2-ynylamino)ethanone (PubChem CID 116589428) has the molecular formula C13H15NO and a molecular weight of 201.27 g/mol. Its IUPAC name is 1-(2,3-dimethylphenyl)-2-(prop-2-ynylamino)ethanone.
| Compound Name | 1-(2,3-dimethylphenyl)-2-(prop-2-ynylamino)ethanone |
|---|---|
| PubChem CID | 116589428 |
| Molecular Formula | C13H15NO |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.12 |
| IUPAC Name | 1-(2,3-dimethylphenyl)-2-(prop-2-ynylamino)ethanone |
| SMILES | C#CCNCC(=O)c1cccc(C)c1C |
| InChI | InChI=1S/C13H15NO/c1-4-8-14-9-13(15)12-7-5-6-10(2)11(12)3/h1,5-7,14H,8-9H2,2-3H3 |
| InChIKey | WRGWMXUYPNJUDQ-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|