C14H17NO2 — CID 116589496
1-(4-methoxy-2,5-dimethylphenyl)-2-(prop-2-ynylamino)ethanone (PubChem CID 116589496) has the molecular formula C14H17NO2 and a molecular weight of 231.29 g/mol. Its IUPAC name is 1-(4-methoxy-2,5-dimethylphenyl)-2-(prop-2-ynylamino)ethanone.
| Compound Name | 1-(4-methoxy-2,5-dimethylphenyl)-2-(prop-2-ynylamino)ethanone |
|---|---|
| PubChem CID | 116589496 |
| Molecular Formula | C14H17NO2 |
| Molecular Weight | 231.29 g/mol |
| Exact Mass | 231.13 |
| IUPAC Name | 1-(4-methoxy-2,5-dimethylphenyl)-2-(prop-2-ynylamino)ethanone |
| SMILES | C#CCNCC(=O)c1cc(C)c(OC)cc1C |
| InChI | InChI=1S/C14H17NO2/c1-5-6-15-9-13(16)12-7-11(3)14(17-4)8-10(12)2/h1,7-8,15H,6,9H2,2-4H3 |
| InChIKey | GAFZPMWQJZGAMI-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.29 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|