C13H13F3O3 — CID 98579550
4,4,4-trifluoro-1-(4-methoxy-2,5-dimethylphenyl)butane-1,3-dione (PubChem CID 98579550) has the molecular formula C13H13F3O3 and a molecular weight of 274.24 g/mol. Its IUPAC name is 4,4,4-trifluoro-1-(4-methoxy-2,5-dimethylphenyl)butane-1,3-dione.
| Compound Name | 4,4,4-trifluoro-1-(4-methoxy-2,5-dimethylphenyl)butane-1,3-dione |
|---|---|
| PubChem CID | 98579550 |
| Molecular Formula | C13H13F3O3 |
| Molecular Weight | 274.24 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | 4,4,4-trifluoro-1-(4-methoxy-2,5-dimethylphenyl)butane-1,3-dione |
| SMILES | COc1cc(C)c(C(=O)CC(=O)C(F)(F)F)cc1C |
| InChI | InChI=1S/C13H13F3O3/c1-7-5-11(19-3)8(2)4-9(7)10(17)6-12(18)13(14,15)16/h4-5H,6H2,1-3H3 |
| InChIKey | LCSWDYRKOBFBBT-UHFFFAOYSA-N |
| XLogP | 3.02 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.24 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|