C16H20F3NO — CID 116592401
1-[4-(aminomethyl)cyclohexyl]-2-[4-(trifluoromethyl)phenyl]ethanone (PubChem CID 116592401) has the molecular formula C16H20F3NO and a molecular weight of 299.34 g/mol. Its IUPAC name is 1-[4-(aminomethyl)cyclohexyl]-2-[4-(trifluoromethyl)phenyl]ethanone.
| Compound Name | 1-[4-(aminomethyl)cyclohexyl]-2-[4-(trifluoromethyl)phenyl]ethanone |
|---|---|
| PubChem CID | 116592401 |
| Molecular Formula | C16H20F3NO |
| Molecular Weight | 299.34 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | 1-[4-(aminomethyl)cyclohexyl]-2-[4-(trifluoromethyl)phenyl]ethanone |
| SMILES | NCC1CCC(C(=O)Cc2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C16H20F3NO/c17-16(18,19)14-7-3-11(4-8-14)9-15(21)13-5-1-12(10-20)2-6-13/h3-4,7-8,12-13H,1-2,5-6,9-10,20H2 |
| InChIKey | JSQIKLRCRCDEIE-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |