About N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-7-amine;hydrochloride
N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-7-amine;hydrochloride (PubChem CID 11659501) has the molecular formula C16H17ClFN3
and a molecular weight of 305.78 g/mol. Its IUPAC name is N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-7-amine;hydrochloride.
Molecular Properties
| Compound Name | N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-7-amine;hydrochloride |
| PubChem CID | 11659501 |
| Molecular Formula | C16H17ClFN3 |
| Molecular Weight | 305.78 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-7-amine;hydrochloride |
| SMILES | Cc1[nH]c2c(NCc3ccc(F)cc3)cncc2c1C.Cl |
| InChI | InChI=1S/C16H16FN3.ClH/c1-10-11(2)20-16-14(10)8-18-9-15(16)19-7-12-3-5-13(17)6-4-12;/h3-6,8-9,19-20H,7H2,1-2H3;1H |
| InChIKey | QNZZVDPNZJTZPD-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 40.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.78 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-7-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-7-amine;hydrochloride?
The IUPAC name of N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-7-amine;hydrochloride (CID 11659501) is N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-7-amine;hydrochloride.
What is the SMILES notation for N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-7-amine;hydrochloride?
The canonical SMILES for N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-7-amine;hydrochloride is Cc1[nH]c2c(NCc3ccc(F)cc3)cncc2c1C.Cl.
What is the InChIKey of N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-7-amine;hydrochloride?
The InChIKey is QNZZVDPNZJTZPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H16FN3.ClH/c1-10-11(2)20-16-14(10)8-18-9-15(16)19-7-12-3-5-13(17)6-4-12;/h3-6,8-9,19-20H,7H2,1-2H3;1H.
What are the key properties of N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-7-amine;hydrochloride?
N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-7-amine;hydrochloride has a molecular weight of 305.78 g/mol, XLogP of 4.35, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(4-fluorophenyl)methyl]-2,3-dimethyl-1H-pyrrolo[3,2-c]pyridin-7-amine;hydrochloride is sourced from PubChem (CID 11659501), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).