C19H19FN2O — CID 11659585
7-[(4-fluorophenyl)methoxy]-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine (PubChem CID 11659585) has the molecular formula C19H19FN2O and a molecular weight of 310.37 g/mol. Its IUPAC name is 7-[(4-fluorophenyl)methoxy]-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine.
| Compound Name | 7-[(4-fluorophenyl)methoxy]-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine |
|---|---|
| PubChem CID | 11659585 |
| Molecular Formula | C19H19FN2O |
| Molecular Weight | 310.37 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 7-[(4-fluorophenyl)methoxy]-2,3-dimethyl-1-prop-2-enylpyrrolo[2,3-c]pyridine |
| SMILES | C=CCn1c(C)c(C)c2ccnc(OCc3ccc(F)cc3)c21 |
| InChI | InChI=1S/C19H19FN2O/c1-4-11-22-14(3)13(2)17-9-10-21-19(18(17)22)23-12-15-5-7-16(20)8-6-15/h4-10H,1,11-12H2,2-3H3 |
| InChIKey | HQCFKFVUMUQNAO-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.37 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|