About 8-aminoundec-2-yn-6-one
8-aminoundec-2-yn-6-one (PubChem CID 116608034) has the molecular formula C11H19NO
and a molecular weight of 181.28 g/mol. Its IUPAC name is 8-aminoundec-2-yn-6-one.
Molecular Properties
| Compound Name | 8-aminoundec-2-yn-6-one |
| PubChem CID | 116608034 |
| Molecular Formula | C11H19NO |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.15 |
| IUPAC Name | 8-aminoundec-2-yn-6-one |
| SMILES | CC#CCCC(=O)CC(N)CCC |
| InChI | InChI=1S/C11H19NO/c1-3-5-6-8-11(13)9-10(12)7-4-2/h10H,4,6-9,12H2,1-2H3 |
| InChIKey | LDVNZYBNEYENMZ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 8-aminoundec-2-yn-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-aminoundec-2-yn-6-one?
The IUPAC name of 8-aminoundec-2-yn-6-one (CID 116608034) is 8-aminoundec-2-yn-6-one.
What is the SMILES notation for 8-aminoundec-2-yn-6-one?
The canonical SMILES for 8-aminoundec-2-yn-6-one is CC#CCCC(=O)CC(N)CCC.
What is the InChIKey of 8-aminoundec-2-yn-6-one?
The InChIKey is LDVNZYBNEYENMZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H19NO/c1-3-5-6-8-11(13)9-10(12)7-4-2/h10H,4,6-9,12H2,1-2H3.
What are the key properties of 8-aminoundec-2-yn-6-one?
8-aminoundec-2-yn-6-one has a molecular weight of 181.28 g/mol, XLogP of 1.88, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-aminoundec-2-yn-6-one is sourced from PubChem (CID 116608034), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).