About 3-aminohexanoyl chloride;hydrochloride
3-aminohexanoyl chloride;hydrochloride (PubChem CID 174572302) has the molecular formula C6H13Cl2NO
and a molecular weight of 186.08 g/mol. Its IUPAC name is 3-aminohexanoyl chloride;hydrochloride.
Molecular Properties
| Compound Name | 3-aminohexanoyl chloride;hydrochloride |
| PubChem CID | 174572302 |
| Molecular Formula | C6H13Cl2NO |
| Molecular Weight | 186.08 g/mol |
| Exact Mass | 185.04 |
| IUPAC Name | 3-aminohexanoyl chloride;hydrochloride |
| SMILES | CCCC(N)CC(=O)Cl.Cl |
| InChI | InChI=1S/C6H12ClNO.ClH/c1-2-3-5(8)4-6(7)9;/h5H,2-4,8H2,1H3;1H |
| InChIKey | YULVSXKAJUPOGC-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 43.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.08 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-aminohexanoyl chloride;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminohexanoyl chloride;hydrochloride?
The IUPAC name of 3-aminohexanoyl chloride;hydrochloride (CID 174572302) is 3-aminohexanoyl chloride;hydrochloride.
What is the SMILES notation for 3-aminohexanoyl chloride;hydrochloride?
The canonical SMILES for 3-aminohexanoyl chloride;hydrochloride is CCCC(N)CC(=O)Cl.Cl.
What is the InChIKey of 3-aminohexanoyl chloride;hydrochloride?
The InChIKey is YULVSXKAJUPOGC-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12ClNO.ClH/c1-2-3-5(8)4-6(7)9;/h5H,2-4,8H2,1H3;1H.
What are the key properties of 3-aminohexanoyl chloride;hydrochloride?
3-aminohexanoyl chloride;hydrochloride has a molecular weight of 186.08 g/mol, XLogP of 1.69, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminohexanoyl chloride;hydrochloride is sourced from PubChem (CID 174572302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).