About 3-(chloromethyl)hexanoyl chloride
3-(chloromethyl)hexanoyl chloride (PubChem CID 174921831) has the molecular formula C7H12Cl2O
and a molecular weight of 183.08 g/mol. Its IUPAC name is 3-(chloromethyl)hexanoyl chloride.
Molecular Properties
| Compound Name | 3-(chloromethyl)hexanoyl chloride |
| PubChem CID | 174921831 |
| Molecular Formula | C7H12Cl2O |
| Molecular Weight | 183.08 g/mol |
| Exact Mass | 182.03 |
| IUPAC Name | 3-(chloromethyl)hexanoyl chloride |
| SMILES | CCCC(CCl)CC(=O)Cl |
| InChI | InChI=1S/C7H12Cl2O/c1-2-3-6(5-8)4-7(9)10/h6H,2-5H2,1H3 |
| InChIKey | NYIXDCWAFHWQTI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.08 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-(chloromethyl)hexanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(chloromethyl)hexanoyl chloride?
The IUPAC name of 3-(chloromethyl)hexanoyl chloride (CID 174921831) is 3-(chloromethyl)hexanoyl chloride.
What is the SMILES notation for 3-(chloromethyl)hexanoyl chloride?
The canonical SMILES for 3-(chloromethyl)hexanoyl chloride is CCCC(CCl)CC(=O)Cl.
What is the InChIKey of 3-(chloromethyl)hexanoyl chloride?
The InChIKey is NYIXDCWAFHWQTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12Cl2O/c1-2-3-6(5-8)4-7(9)10/h6H,2-5H2,1H3.
What are the key properties of 3-(chloromethyl)hexanoyl chloride?
3-(chloromethyl)hexanoyl chloride has a molecular weight of 183.08 g/mol, XLogP of 2.80, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)hexanoyl chloride is sourced from PubChem (CID 174921831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).