3-(chloromethyl)hexanoyl chloride

C7H12Cl2O — CID 174921831

IUPAC3-(chloromethyl)hexanoyl chloride
SMILESCCCC(CCl)CC(=O)Cl
InChIInChI=1S/C7H12Cl2O/c1-2-3-6(5-8)4-7(9)10/h6H,2-5H2,1H3
InChIKeyNYIXDCWAFHWQTI-UHFFFAOYSA-N
MW183.08 g/mol
LogP2.80
Rot. Bonds5

About 3-(chloromethyl)hexanoyl chloride

3-(chloromethyl)hexanoyl chloride (PubChem CID 174921831) has the molecular formula C7H12Cl2O and a molecular weight of 183.08 g/mol. Its IUPAC name is 3-(chloromethyl)hexanoyl chloride.

Molecular Properties

Compound Name3-(chloromethyl)hexanoyl chloride
PubChem CID174921831
Molecular FormulaC7H12Cl2O
Molecular Weight183.08 g/mol
Exact Mass182.03
IUPAC Name3-(chloromethyl)hexanoyl chloride
SMILESCCCC(CCl)CC(=O)Cl
InChIInChI=1S/C7H12Cl2O/c1-2-3-6(5-8)4-7(9)10/h6H,2-5H2,1H3
InChIKeyNYIXDCWAFHWQTI-UHFFFAOYSA-N
XLogP2.80
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms10
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500183.08
LogP ≤ 52.80
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}

Analyze 3-(chloromethyl)hexanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3-(chloromethyl)hexanoyl chloride?
The IUPAC name of 3-(chloromethyl)hexanoyl chloride (CID 174921831) is 3-(chloromethyl)hexanoyl chloride.
What is the SMILES notation for 3-(chloromethyl)hexanoyl chloride?
The canonical SMILES for 3-(chloromethyl)hexanoyl chloride is CCCC(CCl)CC(=O)Cl.
What is the InChIKey of 3-(chloromethyl)hexanoyl chloride?
The InChIKey is NYIXDCWAFHWQTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12Cl2O/c1-2-3-6(5-8)4-7(9)10/h6H,2-5H2,1H3.
What are the key properties of 3-(chloromethyl)hexanoyl chloride?
3-(chloromethyl)hexanoyl chloride has a molecular weight of 183.08 g/mol, XLogP of 2.80, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(chloromethyl)hexanoyl chloride is sourced from PubChem (CID 174921831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).