4-methylheptanoyl chloride

C8H15ClO — CID 14234515

IUPAC4-methylheptanoyl chloride
SMILESCCCC(C)CCC(=O)Cl
InChIInChI=1S/C8H15ClO/c1-3-4-7(2)5-6-8(9)10/h7H,3-6H2,1-2H3
InChIKeyXOHONTCUBUWVAA-UHFFFAOYSA-N
MW162.66 g/mol
LogP2.97
Rot. Bonds5

About 4-methylheptanoyl chloride

4-methylheptanoyl chloride (PubChem CID 14234515) has the molecular formula C8H15ClO and a molecular weight of 162.66 g/mol. Its IUPAC name is 4-methylheptanoyl chloride.

Molecular Properties

Compound Name4-methylheptanoyl chloride
PubChem CID14234515
Molecular FormulaC8H15ClO
Molecular Weight162.66 g/mol
Exact Mass162.08
IUPAC Name4-methylheptanoyl chloride
SMILESCCCC(C)CCC(=O)Cl
InChIInChI=1S/C8H15ClO/c1-3-4-7(2)5-6-8(9)10/h7H,3-6H2,1-2H3
InChIKeyXOHONTCUBUWVAA-UHFFFAOYSA-N
XLogP2.97
TPSA17.07 Ų
H-Bond Donors
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms10
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.66
LogP ≤ 52.97
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 101

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'acid_halide', 'substructure': 'N/A'}

Analyze 4-methylheptanoyl chloride with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 4-methylheptanoyl chloride?
The IUPAC name of 4-methylheptanoyl chloride (CID 14234515) is 4-methylheptanoyl chloride.
What is the SMILES notation for 4-methylheptanoyl chloride?
The canonical SMILES for 4-methylheptanoyl chloride is CCCC(C)CCC(=O)Cl.
What is the InChIKey of 4-methylheptanoyl chloride?
The InChIKey is XOHONTCUBUWVAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClO/c1-3-4-7(2)5-6-8(9)10/h7H,3-6H2,1-2H3.
What are the key properties of 4-methylheptanoyl chloride?
4-methylheptanoyl chloride has a molecular weight of 162.66 g/mol, XLogP of 2.97, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylheptanoyl chloride is sourced from PubChem (CID 14234515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).