About 4-methylheptanoyl chloride
4-methylheptanoyl chloride (PubChem CID 14234515) has the molecular formula C8H15ClO
and a molecular weight of 162.66 g/mol. Its IUPAC name is 4-methylheptanoyl chloride.
Molecular Properties
| Compound Name | 4-methylheptanoyl chloride |
| PubChem CID | 14234515 |
| Molecular Formula | C8H15ClO |
| Molecular Weight | 162.66 g/mol |
| Exact Mass | 162.08 |
| IUPAC Name | 4-methylheptanoyl chloride |
| SMILES | CCCC(C)CCC(=O)Cl |
| InChI | InChI=1S/C8H15ClO/c1-3-4-7(2)5-6-8(9)10/h7H,3-6H2,1-2H3 |
| InChIKey | XOHONTCUBUWVAA-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.66 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'} |
|---|
Analyze 4-methylheptanoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylheptanoyl chloride?
The IUPAC name of 4-methylheptanoyl chloride (CID 14234515) is 4-methylheptanoyl chloride.
What is the SMILES notation for 4-methylheptanoyl chloride?
The canonical SMILES for 4-methylheptanoyl chloride is CCCC(C)CCC(=O)Cl.
What is the InChIKey of 4-methylheptanoyl chloride?
The InChIKey is XOHONTCUBUWVAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15ClO/c1-3-4-7(2)5-6-8(9)10/h7H,3-6H2,1-2H3.
What are the key properties of 4-methylheptanoyl chloride?
4-methylheptanoyl chloride has a molecular weight of 162.66 g/mol, XLogP of 2.97, 5 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylheptanoyl chloride is sourced from PubChem (CID 14234515), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).