C12H23ClN2O2 — CID 138646659
(3R)-3-(chloromethyl)-N-[(2S)-1-(methylamino)-1-oxobutan-2-yl]hexanamide (PubChem CID 138646659) has the molecular formula C12H23ClN2O2 and a molecular weight of 262.78 g/mol. Its IUPAC name is (3R)-3-(chloromethyl)-N-[(2S)-1-(methylamino)-1-oxobutan-2-yl]hexanamide.
| Compound Name | (3R)-3-(chloromethyl)-N-[(2S)-1-(methylamino)-1-oxobutan-2-yl]hexanamide |
|---|---|
| PubChem CID | 138646659 |
| Molecular Formula | C12H23ClN2O2 |
| Molecular Weight | 262.78 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | (3R)-3-(chloromethyl)-N-[(2S)-1-(methylamino)-1-oxobutan-2-yl]hexanamide |
| SMILES | CCC[C@@H](CCl)CC(=O)N[C@@H](CC)C(=O)NC |
| InChI | InChI=1S/C12H23ClN2O2/c1-4-6-9(8-13)7-11(16)15-10(5-2)12(17)14-3/h9-10H,4-8H2,1-3H3,(H,14,17)(H,15,16)/t9-,10+/m1/s1 |
| InChIKey | NUNWMLULUGVCRR-ZJUUUORDSA-N |
| XLogP | 1.67 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.78 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|