C13H23NOS — CID 116609501
(3,4-dimethylcyclohexyl)-thiomorpholin-3-ylmethanone (PubChem CID 116609501) has the molecular formula C13H23NOS and a molecular weight of 241.40 g/mol. Its IUPAC name is (3,4-dimethylcyclohexyl)-thiomorpholin-3-ylmethanone.
| Compound Name | (3,4-dimethylcyclohexyl)-thiomorpholin-3-ylmethanone |
|---|---|
| PubChem CID | 116609501 |
| Molecular Formula | C13H23NOS |
| Molecular Weight | 241.40 g/mol |
| Exact Mass | 241.15 |
| IUPAC Name | (3,4-dimethylcyclohexyl)-thiomorpholin-3-ylmethanone |
| SMILES | CC1CCC(C(=O)C2CSCCN2)CC1C |
| InChI | InChI=1S/C13H23NOS/c1-9-3-4-11(7-10(9)2)13(15)12-8-16-6-5-14-12/h9-12,14H,3-8H2,1-2H3 |
| InChIKey | HYEBXFAKVPOHHH-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.40 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |