C10H15NO2S — CID 116609702
3,4-dihydro-2H-pyran-5-yl(thiomorpholin-3-yl)methanone (PubChem CID 116609702) has the molecular formula C10H15NO2S and a molecular weight of 213.30 g/mol. Its IUPAC name is 3,4-dihydro-2H-pyran-5-yl(thiomorpholin-3-yl)methanone.
| Compound Name | 3,4-dihydro-2H-pyran-5-yl(thiomorpholin-3-yl)methanone |
|---|---|
| PubChem CID | 116609702 |
| Molecular Formula | C10H15NO2S |
| Molecular Weight | 213.30 g/mol |
| Exact Mass | 213.08 |
| IUPAC Name | 3,4-dihydro-2H-pyran-5-yl(thiomorpholin-3-yl)methanone |
| SMILES | O=C(C1=COCCC1)C1CSCCN1 |
| InChI | InChI=1S/C10H15NO2S/c12-10(8-2-1-4-13-6-8)9-7-14-5-3-11-9/h6,9,11H,1-5,7H2 |
| InChIKey | PDXVSUQUZIZZEI-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.30 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |