C14H19F4NOS — CID 116615228
N-[[3-fluoro-5-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]-2-methylpropan-1-amine (PubChem CID 116615228) has the molecular formula C14H19F4NOS and a molecular weight of 325.37 g/mol. Its IUPAC name is N-[[3-fluoro-5-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]-2-methylpropan-1-amine.
| Compound Name | N-[[3-fluoro-5-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]-2-methylpropan-1-amine |
|---|---|
| PubChem CID | 116615228 |
| Molecular Formula | C14H19F4NOS |
| Molecular Weight | 325.37 g/mol |
| Exact Mass | 325.11 |
| IUPAC Name | N-[[3-fluoro-5-[2-(trifluoromethylsulfanyl)ethoxy]phenyl]methyl]-2-methylpropan-1-amine |
| SMILES | CC(C)CNCc1cc(F)cc(OCCSC(F)(F)F)c1 |
| InChI | InChI=1S/C14H19F4NOS/c1-10(2)8-19-9-11-5-12(15)7-13(6-11)20-3-4-21-14(16,17)18/h5-7,10,19H,3-4,8-9H2,1-2H3 |
| InChIKey | JUDJPFBDLUIVGR-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|