C10H14F3NO2S — CID 116616811
7-[2-(trifluoromethylsulfanyl)ethyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid (PubChem CID 116616811) has the molecular formula C10H14F3NO2S and a molecular weight of 269.29 g/mol. Its IUPAC name is 7-[2-(trifluoromethylsulfanyl)ethyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid.
| Compound Name | 7-[2-(trifluoromethylsulfanyl)ethyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
|---|---|
| PubChem CID | 116616811 |
| Molecular Formula | C10H14F3NO2S |
| Molecular Weight | 269.29 g/mol |
| Exact Mass | 269.07 |
| IUPAC Name | 7-[2-(trifluoromethylsulfanyl)ethyl]-7-azabicyclo[2.2.1]heptane-2-carboxylic acid |
| SMILES | O=C(O)C1CC2CCC1N2CCSC(F)(F)F |
| InChI | InChI=1S/C10H14F3NO2S/c11-10(12,13)17-4-3-14-6-1-2-8(14)7(5-6)9(15)16/h6-8H,1-5H2,(H,15,16) |
| InChIKey | XCPQOZKXUJLWHU-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 269.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |