C12H19F3N2S — CID 116617073
N-[1-[1-[2-(trifluoromethylsulfanyl)ethyl]pyrrol-2-yl]ethyl]propan-1-amine (PubChem CID 116617073) has the molecular formula C12H19F3N2S and a molecular weight of 280.36 g/mol. Its IUPAC name is N-[1-[1-[2-(trifluoromethylsulfanyl)ethyl]pyrrol-2-yl]ethyl]propan-1-amine.
| Compound Name | N-[1-[1-[2-(trifluoromethylsulfanyl)ethyl]pyrrol-2-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 116617073 |
| Molecular Formula | C12H19F3N2S |
| Molecular Weight | 280.36 g/mol |
| Exact Mass | 280.12 |
| IUPAC Name | N-[1-[1-[2-(trifluoromethylsulfanyl)ethyl]pyrrol-2-yl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1cccn1CCSC(F)(F)F |
| InChI | InChI=1S/C12H19F3N2S/c1-3-6-16-10(2)11-5-4-7-17(11)8-9-18-12(13,14)15/h4-5,7,10,16H,3,6,8-9H2,1-2H3 |
| InChIKey | GNZUHBZHJKYNCN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.36 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |