C15H28N2 — CID 79101774
N-[1-[1-(2-methylpentyl)pyrrol-2-yl]ethyl]propan-1-amine (PubChem CID 79101774) has the molecular formula C15H28N2 and a molecular weight of 236.40 g/mol. Its IUPAC name is N-[1-[1-(2-methylpentyl)pyrrol-2-yl]ethyl]propan-1-amine.
| Compound Name | N-[1-[1-(2-methylpentyl)pyrrol-2-yl]ethyl]propan-1-amine |
|---|---|
| PubChem CID | 79101774 |
| Molecular Formula | C15H28N2 |
| Molecular Weight | 236.40 g/mol |
| Exact Mass | 236.23 |
| IUPAC Name | N-[1-[1-(2-methylpentyl)pyrrol-2-yl]ethyl]propan-1-amine |
| SMILES | CCCNC(C)c1cccn1CC(C)CCC |
| InChI | InChI=1S/C15H28N2/c1-5-8-13(3)12-17-11-7-9-15(17)14(4)16-10-6-2/h7,9,11,13-14,16H,5-6,8,10,12H2,1-4H3 |
| InChIKey | GRBSULIEVRNTCE-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.40 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |