C19H36N2 — CID 79108703
N-[1-(1-decylpyrrol-2-yl)ethyl]propan-1-amine (PubChem CID 79108703) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is N-[1-(1-decylpyrrol-2-yl)ethyl]propan-1-amine.
| Compound Name | N-[1-(1-decylpyrrol-2-yl)ethyl]propan-1-amine |
|---|---|
| PubChem CID | 79108703 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | N-[1-(1-decylpyrrol-2-yl)ethyl]propan-1-amine |
| SMILES | CCCCCCCCCCn1cccc1C(C)NCCC |
| InChI | InChI=1S/C19H36N2/c1-4-6-7-8-9-10-11-12-16-21-17-13-14-19(21)18(3)20-15-5-2/h13-14,17-18,20H,4-12,15-16H2,1-3H3 |
| InChIKey | ARFDWBSZHVQXPP-UHFFFAOYSA-N |
| XLogP | 5.69 |
| TPSA | 16.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 5.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|