C10H10F2N2O — CID 116620910
1-(ethoxymethyl)-5,6-difluorobenzimidazole (PubChem CID 116620910) has the molecular formula C10H10F2N2O and a molecular weight of 212.20 g/mol. Its IUPAC name is 1-(ethoxymethyl)-5,6-difluorobenzimidazole.
| Compound Name | 1-(ethoxymethyl)-5,6-difluorobenzimidazole |
|---|---|
| PubChem CID | 116620910 |
| Molecular Formula | C10H10F2N2O |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 1-(ethoxymethyl)-5,6-difluorobenzimidazole |
| SMILES | CCOCn1cnc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C10H10F2N2O/c1-2-15-6-14-5-13-9-3-7(11)8(12)4-10(9)14/h3-5H,2,6H2,1H3 |
| InChIKey | WCKZTYMGXUUPBN-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |