About 1-(2-bromoprop-2-enyl)-5,6-difluorobenzimidazole
1-(2-bromoprop-2-enyl)-5,6-difluorobenzimidazole (PubChem CID 116620789) has the molecular formula C10H7BrF2N2
and a molecular weight of 273.08 g/mol. Its IUPAC name is 1-(2-bromoprop-2-enyl)-5,6-difluorobenzimidazole.
Molecular Properties
| Compound Name | 1-(2-bromoprop-2-enyl)-5,6-difluorobenzimidazole |
| PubChem CID | 116620789 |
| Molecular Formula | C10H7BrF2N2 |
| Molecular Weight | 273.08 g/mol |
| Exact Mass | 271.98 |
| IUPAC Name | 1-(2-bromoprop-2-enyl)-5,6-difluorobenzimidazole |
| SMILES | C=C(Br)Cn1cnc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C10H7BrF2N2/c1-6(11)4-15-5-14-9-2-7(12)8(13)3-10(9)15/h2-3,5H,1,4H2 |
| InChIKey | ULQCEXMMYCQHDP-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 273.08 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(2-bromoprop-2-enyl)-5,6-difluorobenzimidazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-bromoprop-2-enyl)-5,6-difluorobenzimidazole?
The IUPAC name of 1-(2-bromoprop-2-enyl)-5,6-difluorobenzimidazole (CID 116620789) is 1-(2-bromoprop-2-enyl)-5,6-difluorobenzimidazole.
What is the SMILES notation for 1-(2-bromoprop-2-enyl)-5,6-difluorobenzimidazole?
The canonical SMILES for 1-(2-bromoprop-2-enyl)-5,6-difluorobenzimidazole is C=C(Br)Cn1cnc2cc(F)c(F)cc21.
What is the InChIKey of 1-(2-bromoprop-2-enyl)-5,6-difluorobenzimidazole?
The InChIKey is ULQCEXMMYCQHDP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7BrF2N2/c1-6(11)4-15-5-14-9-2-7(12)8(13)3-10(9)15/h2-3,5H,1,4H2.
What are the key properties of 1-(2-bromoprop-2-enyl)-5,6-difluorobenzimidazole?
1-(2-bromoprop-2-enyl)-5,6-difluorobenzimidazole has a molecular weight of 273.08 g/mol, XLogP of 3.22, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-bromoprop-2-enyl)-5,6-difluorobenzimidazole is sourced from PubChem (CID 116620789), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).