C12H12F2N2 — CID 115644249
5,6-difluoro-1-pent-4-enylbenzimidazole (PubChem CID 115644249) has the molecular formula C12H12F2N2 and a molecular weight of 222.24 g/mol. Its IUPAC name is 5,6-difluoro-1-pent-4-enylbenzimidazole.
| Compound Name | 5,6-difluoro-1-pent-4-enylbenzimidazole |
|---|---|
| PubChem CID | 115644249 |
| Molecular Formula | C12H12F2N2 |
| Molecular Weight | 222.24 g/mol |
| Exact Mass | 222.10 |
| IUPAC Name | 5,6-difluoro-1-pent-4-enylbenzimidazole |
| SMILES | C=CCCCn1cnc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C12H12F2N2/c1-2-3-4-5-16-8-15-11-6-9(13)10(14)7-12(11)16/h2,6-8H,1,3-5H2 |
| InChIKey | ZOFOHMASGJTBDA-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.24 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|