C12H14F2N4O — CID 63577412
5-(5,6-difluorobenzimidazol-1-yl)pentanehydrazide (PubChem CID 63577412) has the molecular formula C12H14F2N4O and a molecular weight of 268.27 g/mol. Its IUPAC name is 5-(5,6-difluorobenzimidazol-1-yl)pentanehydrazide.
| Compound Name | 5-(5,6-difluorobenzimidazol-1-yl)pentanehydrazide |
|---|---|
| PubChem CID | 63577412 |
| Molecular Formula | C12H14F2N4O |
| Molecular Weight | 268.27 g/mol |
| Exact Mass | 268.11 |
| IUPAC Name | 5-(5,6-difluorobenzimidazol-1-yl)pentanehydrazide |
| SMILES | NNC(=O)CCCCn1cnc2cc(F)c(F)cc21 |
| InChI | InChI=1S/C12H14F2N4O/c13-8-5-10-11(6-9(8)14)18(7-16-10)4-2-1-3-12(19)17-15/h5-7H,1-4,15H2,(H,17,19) |
| InChIKey | SVVOTBAGBNFDQY-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.27 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|