C18H21ClN4O5S — CID 11662163
1-[2-(4-chloroanilino)-5-nitrophenyl]sulfonyl-3-pentylurea (PubChem CID 11662163) has the molecular formula C18H21ClN4O5S and a molecular weight of 440.91 g/mol. Its IUPAC name is 1-[2-(4-chloroanilino)-5-nitrophenyl]sulfonyl-3-pentylurea.
| Compound Name | 1-[2-(4-chloroanilino)-5-nitrophenyl]sulfonyl-3-pentylurea |
|---|---|
| PubChem CID | 11662163 |
| Molecular Formula | C18H21ClN4O5S |
| Molecular Weight | 440.91 g/mol |
| Exact Mass | 440.09 |
| IUPAC Name | 1-[2-(4-chloroanilino)-5-nitrophenyl]sulfonyl-3-pentylurea |
| SMILES | CCCCCNC(=O)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H21ClN4O5S/c1-2-3-4-11-20-18(24)22-29(27,28)17-12-15(23(25)26)9-10-16(17)21-14-7-5-13(19)6-8-14/h5-10,12,21H,2-4,11H2,1H3,(H2,20,22,24) |
| InChIKey | YOFPLGJBSHLDNE-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 130.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.91 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|