C17H18ClN3O5S2 — CID 11597444
1-tert-butyl-3-[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]sulfonylurea (PubChem CID 11597444) has the molecular formula C17H18ClN3O5S2 and a molecular weight of 443.93 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]sulfonylurea.
| Compound Name | 1-tert-butyl-3-[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]sulfonylurea |
|---|---|
| PubChem CID | 11597444 |
| Molecular Formula | C17H18ClN3O5S2 |
| Molecular Weight | 443.93 g/mol |
| Exact Mass | 443.04 |
| IUPAC Name | 1-tert-butyl-3-[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]sulfonylurea |
| SMILES | CC(C)(C)NC(=O)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C17H18ClN3O5S2/c1-17(2,3)19-16(22)20-28(25,26)15-10-12(21(23)24)6-9-14(15)27-13-7-4-11(18)5-8-13/h4-10H,1-3H3,(H2,19,20,22) |
| InChIKey | DTHMAIBRMAAIJG-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 118.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.93 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|