C19H13ClF2N2O3S — CID 69012664
4-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylamino]-2,6-difluorophenol (PubChem CID 69012664) has the molecular formula C19H13ClF2N2O3S and a molecular weight of 422.84 g/mol. Its IUPAC name is 4-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylamino]-2,6-difluorophenol.
| Compound Name | 4-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylamino]-2,6-difluorophenol |
|---|---|
| PubChem CID | 69012664 |
| Molecular Formula | C19H13ClF2N2O3S |
| Molecular Weight | 422.84 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | 4-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylamino]-2,6-difluorophenol |
| SMILES | O=[N+]([O-])c1ccc(Sc2ccc(Cl)cc2)c(CNc2cc(F)c(O)c(F)c2)c1 |
| InChI | InChI=1S/C19H13ClF2N2O3S/c20-12-1-4-15(5-2-12)28-18-6-3-14(24(26)27)7-11(18)10-23-13-8-16(21)19(25)17(22)9-13/h1-9,23,25H,10H2 |
| InChIKey | APXLXRYQRJANHU-UHFFFAOYSA-N |
| XLogP | 6.00 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.84 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|