C20H16F2N2O3S — CID 69009753
2,6-difluoro-4-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylamino]phenol (PubChem CID 69009753) has the molecular formula C20H16F2N2O3S and a molecular weight of 402.42 g/mol. Its IUPAC name is 2,6-difluoro-4-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylamino]phenol.
| Compound Name | 2,6-difluoro-4-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylamino]phenol |
|---|---|
| PubChem CID | 69009753 |
| Molecular Formula | C20H16F2N2O3S |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 2,6-difluoro-4-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylamino]phenol |
| SMILES | Cc1ccc(Sc2ccc([N+](=O)[O-])cc2CNc2cc(F)c(O)c(F)c2)cc1 |
| InChI | InChI=1S/C20H16F2N2O3S/c1-12-2-5-16(6-3-12)28-19-7-4-15(24(26)27)8-13(19)11-23-14-9-17(21)20(25)18(22)10-14/h2-10,23,25H,11H2,1H3 |
| InChIKey | XMTNZXFJZJVGJO-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|