C41H37ClN4O7S2 — CID 160792735
2-[[5-amino-2-(4-chlorophenyl)sulfanylphenyl]methylamino]-6-(hydroxymethyl)phenol;2-hydroxy-3-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylamino]benzoic acid (PubChem CID 160792735) has the molecular formula C41H37ClN4O7S2 and a molecular weight of 797.36 g/mol. Its IUPAC name is 2-[[5-amino-2-(4-chlorophenyl)sulfanylphenyl]methylamino]-6-(hydroxymethyl)phenol;2-hydroxy-3-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylamino]benzoic acid.
| Compound Name | 2-[[5-amino-2-(4-chlorophenyl)sulfanylphenyl]methylamino]-6-(hydroxymethyl)phenol;2-hydroxy-3-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylamino]benzoic acid |
|---|---|
| PubChem CID | 160792735 |
| Molecular Formula | C41H37ClN4O7S2 |
| Molecular Weight | 797.36 g/mol |
| Exact Mass | 796.18 |
| IUPAC Name | 2-[[5-amino-2-(4-chlorophenyl)sulfanylphenyl]methylamino]-6-(hydroxymethyl)phenol;2-hydroxy-3-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylamino]benzoic acid |
| SMILES | Cc1ccc(Sc2ccc([N+](=O)[O-])cc2CNc2cccc(C(=O)O)c2O)cc1.Nc1ccc(Sc2ccc(Cl)cc2)c(CNc2cccc(CO)c2O)c1 |
| InChI | InChI=1S/C21H18N2O5S.C20H19ClN2O2S/c1-13-5-8-16(9-6-13)29-19-10-7-15(23(27)28)11-14(19)12-22-18-4-2-3-17(20(18)24)21(25)26;21-15-4-7-17(8-5-15)26-19-9-6-16(22)10-14(19)11-23-18-3-1-2-13(12-24)20(18)25/h2-11,22,24H,12H2,1H3,(H,25,26);1-10,23-25H,11-12,22H2 |
| InChIKey | SCAODMMSRMNLOK-UHFFFAOYSA-N |
| XLogP | 9.95 |
| TPSA | 191.21 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 55 |
| Complexity | — |
4 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 797.36 |
| LogP ≤ 5 | 9.95 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|