C21H18Cl2N2O3S — CID 87656411
2,4-dichloro-3-methyl-6-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylamino]phenol (PubChem CID 87656411) has the molecular formula C21H18Cl2N2O3S and a molecular weight of 449.36 g/mol. Its IUPAC name is 2,4-dichloro-3-methyl-6-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylamino]phenol.
| Compound Name | 2,4-dichloro-3-methyl-6-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylamino]phenol |
|---|---|
| PubChem CID | 87656411 |
| Molecular Formula | C21H18Cl2N2O3S |
| Molecular Weight | 449.36 g/mol |
| Exact Mass | 448.04 |
| IUPAC Name | 2,4-dichloro-3-methyl-6-[[2-(4-methylphenyl)sulfanyl-5-nitrophenyl]methylamino]phenol |
| SMILES | Cc1ccc(Sc2ccc([N+](=O)[O-])cc2CNc2cc(Cl)c(C)c(Cl)c2O)cc1 |
| InChI | InChI=1S/C21H18Cl2N2O3S/c1-12-3-6-16(7-4-12)29-19-8-5-15(25(27)28)9-14(19)11-24-18-10-17(22)13(2)20(23)21(18)26/h3-10,24,26H,11H2,1-2H3 |
| InChIKey | WMFZCWBIQUICQU-UHFFFAOYSA-N |
| XLogP | 6.99 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.36 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|