C20H17ClN2O4S — CID 69010523
4-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylamino]-2-(hydroxymethyl)phenol (PubChem CID 69010523) has the molecular formula C20H17ClN2O4S and a molecular weight of 416.89 g/mol. Its IUPAC name is 4-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylamino]-2-(hydroxymethyl)phenol.
| Compound Name | 4-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylamino]-2-(hydroxymethyl)phenol |
|---|---|
| PubChem CID | 69010523 |
| Molecular Formula | C20H17ClN2O4S |
| Molecular Weight | 416.89 g/mol |
| Exact Mass | 416.06 |
| IUPAC Name | 4-[[2-(4-chlorophenyl)sulfanyl-5-nitrophenyl]methylamino]-2-(hydroxymethyl)phenol |
| SMILES | O=[N+]([O-])c1ccc(Sc2ccc(Cl)cc2)c(CNc2ccc(O)c(CO)c2)c1 |
| InChI | InChI=1S/C20H17ClN2O4S/c21-15-1-5-18(6-2-15)28-20-8-4-17(23(26)27)10-13(20)11-22-16-3-7-19(25)14(9-16)12-24/h1-10,22,24-25H,11-12H2 |
| InChIKey | BIXPXCSKGCATDF-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 95.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.89 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|