C38H28Cl5N3O4S2 — CID 161379481
2,4-dichloro-6-[[2-(4-chlorophenyl)sulfanylphenyl]methylamino]phenol;2,4-dichloro-6-[[2-(4-nitrophenyl)sulfanylphenyl]methylamino]phenol (PubChem CID 161379481) has the molecular formula C38H28Cl5N3O4S2 and a molecular weight of 832.06 g/mol. Its IUPAC name is 2,4-dichloro-6-[[2-(4-chlorophenyl)sulfanylphenyl]methylamino]phenol;2,4-dichloro-6-[[2-(4-nitrophenyl)sulfanylphenyl]methylamino]phenol.
| Compound Name | 2,4-dichloro-6-[[2-(4-chlorophenyl)sulfanylphenyl]methylamino]phenol;2,4-dichloro-6-[[2-(4-nitrophenyl)sulfanylphenyl]methylamino]phenol |
|---|---|
| PubChem CID | 161379481 |
| Molecular Formula | C38H28Cl5N3O4S2 |
| Molecular Weight | 832.06 g/mol |
| Exact Mass | 829.00 |
| IUPAC Name | 2,4-dichloro-6-[[2-(4-chlorophenyl)sulfanylphenyl]methylamino]phenol;2,4-dichloro-6-[[2-(4-nitrophenyl)sulfanylphenyl]methylamino]phenol |
| SMILES | O=[N+]([O-])c1ccc(Sc2ccccc2CNc2cc(Cl)cc(Cl)c2O)cc1.Oc1c(Cl)cc(Cl)cc1NCc1ccccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14Cl3NOS.C19H14Cl2N2O3S/c20-13-5-7-15(8-6-13)25-18-4-2-1-3-12(18)11-23-17-10-14(21)9-16(22)19(17)24;20-13-9-16(21)19(24)17(10-13)22-11-12-3-1-2-4-18(12)27-15-7-5-14(6-8-15)23(25)26/h1-10,23-24H,11H2;1-10,22,24H,11H2 |
| InChIKey | VRNKUTFKYXXGDE-UHFFFAOYSA-N |
| XLogP | 13.49 |
| TPSA | 107.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.06 |
| LogP ≤ 5 | 13.49 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|