C19H14BrClFNOS — CID 58828939
4-bromo-2-[[2-(4-chlorophenyl)sulfanylphenyl]methylamino]-6-fluorophenol (PubChem CID 58828939) has the molecular formula C19H14BrClFNOS and a molecular weight of 438.75 g/mol. Its IUPAC name is 4-bromo-2-[[2-(4-chlorophenyl)sulfanylphenyl]methylamino]-6-fluorophenol.
| Compound Name | 4-bromo-2-[[2-(4-chlorophenyl)sulfanylphenyl]methylamino]-6-fluorophenol |
|---|---|
| PubChem CID | 58828939 |
| Molecular Formula | C19H14BrClFNOS |
| Molecular Weight | 438.75 g/mol |
| Exact Mass | 436.97 |
| IUPAC Name | 4-bromo-2-[[2-(4-chlorophenyl)sulfanylphenyl]methylamino]-6-fluorophenol |
| SMILES | Oc1c(F)cc(Br)cc1NCc1ccccc1Sc1ccc(Cl)cc1 |
| InChI | InChI=1S/C19H14BrClFNOS/c20-13-9-16(22)19(24)17(10-13)23-11-12-3-1-2-4-18(12)25-15-7-5-14(21)6-8-15/h1-10,23-24H,11H2 |
| InChIKey | FOQIUNYPZIPKAY-UHFFFAOYSA-N |
| XLogP | 6.71 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.75 |
| LogP ≤ 5 | 6.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|