C21H18F2N2O2S — CID 69013689
N-[4-[2-[(3,4-difluoro-2-hydroxyanilino)methyl]phenyl]sulfanylphenyl]acetamide (PubChem CID 69013689) has the molecular formula C21H18F2N2O2S and a molecular weight of 400.45 g/mol. Its IUPAC name is N-[4-[2-[(3,4-difluoro-2-hydroxyanilino)methyl]phenyl]sulfanylphenyl]acetamide.
| Compound Name | N-[4-[2-[(3,4-difluoro-2-hydroxyanilino)methyl]phenyl]sulfanylphenyl]acetamide |
|---|---|
| PubChem CID | 69013689 |
| Molecular Formula | C21H18F2N2O2S |
| Molecular Weight | 400.45 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | N-[4-[2-[(3,4-difluoro-2-hydroxyanilino)methyl]phenyl]sulfanylphenyl]acetamide |
| SMILES | CC(=O)Nc1ccc(Sc2ccccc2CNc2ccc(F)c(F)c2O)cc1 |
| InChI | InChI=1S/C21H18F2N2O2S/c1-13(26)25-15-6-8-16(9-7-15)28-19-5-3-2-4-14(19)12-24-18-11-10-17(22)20(23)21(18)27/h2-11,24,27H,12H2,1H3,(H,25,26) |
| InChIKey | SYMAVFAQFXORDA-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|