C22H19ClINO2S — CID 173221471
1-[5-chloro-2-hydroxy-3-[[2-(4-methylphenyl)sulfanylphenyl]methylamino]phenyl]-2-iodoethanone (PubChem CID 173221471) has the molecular formula C22H19ClINO2S and a molecular weight of 523.82 g/mol. Its IUPAC name is 1-[5-chloro-2-hydroxy-3-[[2-(4-methylphenyl)sulfanylphenyl]methylamino]phenyl]-2-iodoethanone.
| Compound Name | 1-[5-chloro-2-hydroxy-3-[[2-(4-methylphenyl)sulfanylphenyl]methylamino]phenyl]-2-iodoethanone |
|---|---|
| PubChem CID | 173221471 |
| Molecular Formula | C22H19ClINO2S |
| Molecular Weight | 523.82 g/mol |
| Exact Mass | 522.99 |
| IUPAC Name | 1-[5-chloro-2-hydroxy-3-[[2-(4-methylphenyl)sulfanylphenyl]methylamino]phenyl]-2-iodoethanone |
| SMILES | Cc1ccc(Sc2ccccc2CNc2cc(Cl)cc(C(=O)CI)c2O)cc1 |
| InChI | InChI=1S/C22H19ClINO2S/c1-14-6-8-17(9-7-14)28-21-5-3-2-4-15(21)13-25-19-11-16(23)10-18(22(19)27)20(26)12-24/h2-11,25,27H,12-13H2,1H3 |
| InChIKey | DWZKDOOKGYBQRB-UHFFFAOYSA-N |
| XLogP | 6.74 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.82 |
| LogP ≤ 5 | 6.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|