C24H23N3O8S — CID 71815929
4-[3-[2-(tert-butylcarbamoylsulfamoyl)-4-nitrophenoxy]phenyl]benzoic acid (PubChem CID 71815929) has the molecular formula C24H23N3O8S and a molecular weight of 513.53 g/mol. Its IUPAC name is 4-[3-[2-(tert-butylcarbamoylsulfamoyl)-4-nitrophenoxy]phenyl]benzoic acid.
| Compound Name | 4-[3-[2-(tert-butylcarbamoylsulfamoyl)-4-nitrophenoxy]phenyl]benzoic acid |
|---|---|
| PubChem CID | 71815929 |
| Molecular Formula | C24H23N3O8S |
| Molecular Weight | 513.53 g/mol |
| Exact Mass | 513.12 |
| IUPAC Name | 4-[3-[2-(tert-butylcarbamoylsulfamoyl)-4-nitrophenoxy]phenyl]benzoic acid |
| SMILES | CC(C)(C)NC(=O)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Oc1cccc(-c2ccc(C(=O)O)cc2)c1 |
| InChI | InChI=1S/C24H23N3O8S/c1-24(2,3)25-23(30)26-36(33,34)21-14-18(27(31)32)11-12-20(21)35-19-6-4-5-17(13-19)15-7-9-16(10-8-15)22(28)29/h4-14H,1-3H3,(H,28,29)(H2,25,26,30) |
| InChIKey | FKFOTJBQNAGDAZ-UHFFFAOYSA-N |
| XLogP | 4.54 |
| TPSA | 164.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.53 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|