C48H50N6O14S2 — CID 158698872
1-tert-butyl-3-[2-[2-(4-methoxyphenyl)phenoxy]-5-nitrophenyl]sulfonylurea;1-tert-butyl-3-[2-[3-(4-methoxyphenyl)phenoxy]-5-nitrophenyl]sulfonylurea (PubChem CID 158698872) has the molecular formula C48H50N6O14S2 and a molecular weight of 999.09 g/mol. Its IUPAC name is 1-tert-butyl-3-[2-[2-(4-methoxyphenyl)phenoxy]-5-nitrophenyl]sulfonylurea;1-tert-butyl-3-[2-[3-(4-methoxyphenyl)phenoxy]-5-nitrophenyl]sulfonylurea.
| Compound Name | 1-tert-butyl-3-[2-[2-(4-methoxyphenyl)phenoxy]-5-nitrophenyl]sulfonylurea;1-tert-butyl-3-[2-[3-(4-methoxyphenyl)phenoxy]-5-nitrophenyl]sulfonylurea |
|---|---|
| PubChem CID | 158698872 |
| Molecular Formula | C48H50N6O14S2 |
| Molecular Weight | 999.09 g/mol |
| Exact Mass | 998.28 |
| IUPAC Name | 1-tert-butyl-3-[2-[2-(4-methoxyphenyl)phenoxy]-5-nitrophenyl]sulfonylurea;1-tert-butyl-3-[2-[3-(4-methoxyphenyl)phenoxy]-5-nitrophenyl]sulfonylurea |
| SMILES | COc1ccc(-c2cccc(Oc3ccc([N+](=O)[O-])cc3S(=O)(=O)NC(=O)NC(C)(C)C)c2)cc1.COc1ccc(-c2ccccc2Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)NC(=O)NC(C)(C)C)cc1 |
| InChI | InChI=1S/2C24H25N3O7S/c1-24(2,3)25-23(28)26-35(31,32)22-15-18(27(29)30)10-13-21(22)34-20-7-5-6-17(14-20)16-8-11-19(33-4)12-9-16;1-24(2,3)25-23(28)26-35(31,32)22-15-17(27(29)30)11-14-21(22)34-20-8-6-5-7-19(20)16-9-12-18(33-4)13-10-16/h2*5-15H,1-4H3,(H2,25,26,28) |
| InChIKey | IHGXSXAYCPAVQR-UHFFFAOYSA-N |
| XLogP | 9.70 |
| TPSA | 273.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 70 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 999.09 |
| LogP ≤ 5 | 9.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|