C24H27N3O8S — CID 71815931
methyl 6-[3-[2-(tert-butylcarbamoylsulfamoyl)-4-nitrophenoxy]phenyl]hex-5-ynoate (PubChem CID 71815931) has the molecular formula C24H27N3O8S and a molecular weight of 517.56 g/mol. Its IUPAC name is methyl 6-[3-[2-(tert-butylcarbamoylsulfamoyl)-4-nitrophenoxy]phenyl]hex-5-ynoate.
| Compound Name | methyl 6-[3-[2-(tert-butylcarbamoylsulfamoyl)-4-nitrophenoxy]phenyl]hex-5-ynoate |
|---|---|
| PubChem CID | 71815931 |
| Molecular Formula | C24H27N3O8S |
| Molecular Weight | 517.56 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | methyl 6-[3-[2-(tert-butylcarbamoylsulfamoyl)-4-nitrophenoxy]phenyl]hex-5-ynoate |
| SMILES | COC(=O)CCCC#Cc1cccc(Oc2ccc([N+](=O)[O-])cc2S(=O)(=O)NC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C24H27N3O8S/c1-24(2,3)25-23(29)26-36(32,33)21-16-18(27(30)31)13-14-20(21)35-19-11-8-10-17(15-19)9-6-5-7-12-22(28)34-4/h8,10-11,13-16H,5,7,12H2,1-4H3,(H2,25,26,29) |
| InChIKey | PRSUVCSYBYZYOF-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 153.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.56 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|