C18H23N5O5S — CID 174623314
1-[2-[4-(aminomethyl)anilino]-5-nitrophenyl]sulfonyl-3-tert-butylurea (PubChem CID 174623314) has the molecular formula C18H23N5O5S and a molecular weight of 421.48 g/mol. Its IUPAC name is 1-[2-[4-(aminomethyl)anilino]-5-nitrophenyl]sulfonyl-3-tert-butylurea.
| Compound Name | 1-[2-[4-(aminomethyl)anilino]-5-nitrophenyl]sulfonyl-3-tert-butylurea |
|---|---|
| PubChem CID | 174623314 |
| Molecular Formula | C18H23N5O5S |
| Molecular Weight | 421.48 g/mol |
| Exact Mass | 421.14 |
| IUPAC Name | 1-[2-[4-(aminomethyl)anilino]-5-nitrophenyl]sulfonyl-3-tert-butylurea |
| SMILES | CC(C)(C)NC(=O)NS(=O)(=O)c1cc([N+](=O)[O-])ccc1Nc1ccc(CN)cc1 |
| InChI | InChI=1S/C18H23N5O5S/c1-18(2,3)21-17(24)22-29(27,28)16-10-14(23(25)26)8-9-15(16)20-13-6-4-12(11-19)5-7-13/h4-10,20H,11,19H2,1-3H3,(H2,21,22,24) |
| InChIKey | YKPRLLFWNQUUGR-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 156.46 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.48 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|