C27H22N6O10S2 — CID 19966682
1-(3-nitrophenyl)sulfonyl-3-[4-[[4-[(3-nitrophenyl)sulfonylcarbamoylamino]phenyl]methyl]phenyl]urea (PubChem CID 19966682) has the molecular formula C27H22N6O10S2 and a molecular weight of 654.64 g/mol. Its IUPAC name is 1-(3-nitrophenyl)sulfonyl-3-[4-[[4-[(3-nitrophenyl)sulfonylcarbamoylamino]phenyl]methyl]phenyl]urea.
| Compound Name | 1-(3-nitrophenyl)sulfonyl-3-[4-[[4-[(3-nitrophenyl)sulfonylcarbamoylamino]phenyl]methyl]phenyl]urea |
|---|---|
| PubChem CID | 19966682 |
| Molecular Formula | C27H22N6O10S2 |
| Molecular Weight | 654.64 g/mol |
| Exact Mass | 654.08 |
| IUPAC Name | 1-(3-nitrophenyl)sulfonyl-3-[4-[[4-[(3-nitrophenyl)sulfonylcarbamoylamino]phenyl]methyl]phenyl]urea |
| SMILES | O=C(Nc1ccc(Cc2ccc(NC(=O)NS(=O)(=O)c3cccc([N+](=O)[O-])c3)cc2)cc1)NS(=O)(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C27H22N6O10S2/c34-26(30-44(40,41)24-5-1-3-22(16-24)32(36)37)28-20-11-7-18(8-12-20)15-19-9-13-21(14-10-19)29-27(35)31-45(42,43)25-6-2-4-23(17-25)33(38)39/h1-14,16-17H,15H2,(H2,28,30,34)(H2,29,31,35) |
| InChIKey | AMLZFUWXHNLDJR-UHFFFAOYSA-N |
| XLogP | 4.11 |
| TPSA | 236.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 654.64 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|