C27H28N4O3S — CID 155373284
4-[3-[2-(tert-butylcarbamoylamino)sulfanyl-4-cyanophenoxy]phenyl]-N,N-dimethylbenzamide (PubChem CID 155373284) has the molecular formula C27H28N4O3S and a molecular weight of 488.61 g/mol. Its IUPAC name is 4-[3-[2-(tert-butylcarbamoylamino)sulfanyl-4-cyanophenoxy]phenyl]-N,N-dimethylbenzamide.
| Compound Name | 4-[3-[2-(tert-butylcarbamoylamino)sulfanyl-4-cyanophenoxy]phenyl]-N,N-dimethylbenzamide |
|---|---|
| PubChem CID | 155373284 |
| Molecular Formula | C27H28N4O3S |
| Molecular Weight | 488.61 g/mol |
| Exact Mass | 488.19 |
| IUPAC Name | 4-[3-[2-(tert-butylcarbamoylamino)sulfanyl-4-cyanophenoxy]phenyl]-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1ccc(-c2cccc(Oc3ccc(C#N)cc3SNC(=O)NC(C)(C)C)c2)cc1 |
| InChI | InChI=1S/C27H28N4O3S/c1-27(2,3)29-26(33)30-35-24-15-18(17-28)9-14-23(24)34-22-8-6-7-21(16-22)19-10-12-20(13-11-19)25(32)31(4)5/h6-16H,1-5H3,(H2,29,30,33) |
| InChIKey | XMUGYYKDUOQWHR-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 94.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.61 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|