C25H23F2N3O3S — CID 155373228
1-tert-butyl-3-[5-cyano-2-[3-[4-(difluoromethoxy)phenyl]phenoxy]phenyl]sulfanylurea (PubChem CID 155373228) has the molecular formula C25H23F2N3O3S and a molecular weight of 483.54 g/mol. Its IUPAC name is 1-tert-butyl-3-[5-cyano-2-[3-[4-(difluoromethoxy)phenyl]phenoxy]phenyl]sulfanylurea.
| Compound Name | 1-tert-butyl-3-[5-cyano-2-[3-[4-(difluoromethoxy)phenyl]phenoxy]phenyl]sulfanylurea |
|---|---|
| PubChem CID | 155373228 |
| Molecular Formula | C25H23F2N3O3S |
| Molecular Weight | 483.54 g/mol |
| Exact Mass | 483.14 |
| IUPAC Name | 1-tert-butyl-3-[5-cyano-2-[3-[4-(difluoromethoxy)phenyl]phenoxy]phenyl]sulfanylurea |
| SMILES | CC(C)(C)NC(=O)NSc1cc(C#N)ccc1Oc1cccc(-c2ccc(OC(F)F)cc2)c1 |
| InChI | InChI=1S/C25H23F2N3O3S/c1-25(2,3)29-24(31)30-34-22-13-16(15-28)7-12-21(22)32-20-6-4-5-18(14-20)17-8-10-19(11-9-17)33-23(26)27/h4-14,23H,1-3H3,(H2,29,30,31) |
| InChIKey | IYRMEHJDTSWMTD-UHFFFAOYSA-N |
| XLogP | 6.72 |
| TPSA | 83.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 483.54 |
| LogP ≤ 5 | 6.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|