C25H24N4O5S — CID 162435787
1-[2-[3-[4-[amino(hydroxy)methyl]phenyl]phenoxy]-5-cyanophenyl]sulfonyl-3-(1-methylcyclopropyl)urea (PubChem CID 162435787) has the molecular formula C25H24N4O5S and a molecular weight of 492.56 g/mol. Its IUPAC name is 1-[2-[3-[4-[amino(hydroxy)methyl]phenyl]phenoxy]-5-cyanophenyl]sulfonyl-3-(1-methylcyclopropyl)urea.
| Compound Name | 1-[2-[3-[4-[amino(hydroxy)methyl]phenyl]phenoxy]-5-cyanophenyl]sulfonyl-3-(1-methylcyclopropyl)urea |
|---|---|
| PubChem CID | 162435787 |
| Molecular Formula | C25H24N4O5S |
| Molecular Weight | 492.56 g/mol |
| Exact Mass | 492.15 |
| IUPAC Name | 1-[2-[3-[4-[amino(hydroxy)methyl]phenyl]phenoxy]-5-cyanophenyl]sulfonyl-3-(1-methylcyclopropyl)urea |
| SMILES | CC1(NC(=O)NS(=O)(=O)c2cc(C#N)ccc2Oc2cccc(-c3ccc(C(N)O)cc3)c2)CC1 |
| InChI | InChI=1S/C25H24N4O5S/c1-25(11-12-25)28-24(31)29-35(32,33)22-13-16(15-26)5-10-21(22)34-20-4-2-3-19(14-20)17-6-8-18(9-7-17)23(27)30/h2-10,13-14,23,30H,11-12,27H2,1H3,(H2,28,29,31) |
| InChIKey | DGOQYBYVFAMOPW-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 154.54 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.56 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|