C20H23N3O4S — CID 71740182
1-[5-cyano-2-(3-methylphenoxy)phenyl]sulfonyl-3-pentylurea (PubChem CID 71740182) has the molecular formula C20H23N3O4S and a molecular weight of 401.49 g/mol. Its IUPAC name is 1-[5-cyano-2-(3-methylphenoxy)phenyl]sulfonyl-3-pentylurea.
| Compound Name | 1-[5-cyano-2-(3-methylphenoxy)phenyl]sulfonyl-3-pentylurea |
|---|---|
| PubChem CID | 71740182 |
| Molecular Formula | C20H23N3O4S |
| Molecular Weight | 401.49 g/mol |
| Exact Mass | 401.14 |
| IUPAC Name | 1-[5-cyano-2-(3-methylphenoxy)phenyl]sulfonyl-3-pentylurea |
| SMILES | CCCCCNC(=O)NS(=O)(=O)c1cc(C#N)ccc1Oc1cccc(C)c1 |
| InChI | InChI=1S/C20H23N3O4S/c1-3-4-5-11-22-20(24)23-28(25,26)19-13-16(14-21)9-10-18(19)27-17-8-6-7-15(2)12-17/h6-10,12-13H,3-5,11H2,1-2H3,(H2,22,23,24) |
| InChIKey | DZIAGOHVRJMYIZ-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 108.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.49 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|